C23H22N4O3 — CID 171556020
cis-(1R,2R)-N-[7-(6-butanoyl-4-methyl-3-pyridinyl)-2,6-naphthyridin-3-yl]-2-formylcyclopropane-1-carboxamide (PubChem CID 171556020) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is cis-(1R,2R)-N-[7-(6-butanoyl-4-methyl-3-pyridinyl)-2,6-naphthyridin-3-yl]-2-formylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2R)-N-[7-(6-butanoyl-4-methyl-3-pyridinyl)-2,6-naphthyridin-3-yl]-2-formylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 171556020 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | cis-(1R,2R)-N-[7-(6-butanoyl-4-methyl-3-pyridinyl)-2,6-naphthyridin-3-yl]-2-formylcyclopropane-1-carboxamide |
| SMILES | CCCC(=O)c1cc(C)c(-c2cc3cnc(NC(=O)[C@@H]4C[C@H]4C=O)cc3cn2)cn1 |
| InChI | InChI=1S/C23H22N4O3/c1-3-4-21(29)20-5-13(2)18(11-25-20)19-7-14-10-26-22(8-15(14)9-24-19)27-23(30)17-6-16(17)12-28/h5,7-12,16-17H,3-4,6H2,1-2H3,(H,26,27,30)/t16-,17+/m0/s1 |
| InChIKey | ZCEVXFCJMYXCDD-DLBZAZTESA-N |
| XLogP | 3.76 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|