C15H18F3NO4 — CID 171556566
(2R,3R,4S,5S)-2-(2-methylprop-2-enyl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol (PubChem CID 171556566) has the molecular formula C15H18F3NO4 and a molecular weight of 333.31 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(2-methylprop-2-enyl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(2-methylprop-2-enyl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 171556566 |
| Molecular Formula | C15H18F3NO4 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (2R,3R,4S,5S)-2-(2-methylprop-2-enyl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
| SMILES | C=C(C)C[C@H]1OC[C@H](Oc2cccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H18F3NO4/c1-8(2)6-9-13(20)14(21)10(7-22-9)23-12-5-3-4-11(19-12)15(16,17)18/h3-5,9-10,13-14,20-21H,1,6-7H2,2H3/t9-,10+,13+,14-/m1/s1 |
| InChIKey | TURCDPYIVOVITI-XXSPCDMZSA-N |
| XLogP | 1.93 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|