C22H30F3N3O6 — CID 171556594
tert-butyl 3-[[(2R,3R,4S,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]methyl]-3,6-diazabicyclo[3.2.0]heptane-6-carboxylate (PubChem CID 171556594) has the molecular formula C22H30F3N3O6 and a molecular weight of 489.49 g/mol. Its IUPAC name is tert-butyl 3-[[(2R,3R,4S,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]methyl]-3,6-diazabicyclo[3.2.0]heptane-6-carboxylate.
| Compound Name | tert-butyl 3-[[(2R,3R,4S,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]methyl]-3,6-diazabicyclo[3.2.0]heptane-6-carboxylate |
|---|---|
| PubChem CID | 171556594 |
| Molecular Formula | C22H30F3N3O6 |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | tert-butyl 3-[[(2R,3R,4S,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]methyl]-3,6-diazabicyclo[3.2.0]heptane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CN(C[C@H]3OC[C@H](Oc4cccc(C(F)(F)F)n4)[C@@H](O)[C@H]3O)CC21 |
| InChI | InChI=1S/C22H30F3N3O6/c1-21(2,3)34-20(31)28-8-12-7-27(9-13(12)28)10-14-18(29)19(30)15(11-32-14)33-17-6-4-5-16(26-17)22(23,24)25/h4-6,12-15,18-19,29-30H,7-11H2,1-3H3/t12?,13?,14-,15+,18+,19-/m1/s1 |
| InChIKey | ZZNOTPQLSYKNOU-NNVVWSOGSA-N |
| XLogP | 1.52 |
| TPSA | 104.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |