C22H27F3N4O4 — CID 171556678
N-[(3aS,7S,7aR)-4-[(3-methoxy-N-methylanilino)methyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171556678) has the molecular formula C22H27F3N4O4 and a molecular weight of 468.48 g/mol. Its IUPAC name is N-[(3aS,7S,7aR)-4-[(3-methoxy-N-methylanilino)methyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | N-[(3aS,7S,7aR)-4-[(3-methoxy-N-methylanilino)methyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171556678 |
| Molecular Formula | C22H27F3N4O4 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | N-[(3aS,7S,7aR)-4-[(3-methoxy-N-methylanilino)methyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | COc1cccc(N(C)CC2OC[C@H](Nc3cncc(C(F)(F)F)n3)[C@H]3OC(C)(C)O[C@@H]23)c1 |
| InChI | InChI=1S/C22H27F3N4O4/c1-21(2)32-19-15(27-18-10-26-9-17(28-18)22(23,24)25)12-31-16(20(19)33-21)11-29(3)13-6-5-7-14(8-13)30-4/h5-10,15-16,19-20H,11-12H2,1-4H3,(H,27,28)/t15-,16?,19+,20-/m0/s1 |
| InChIKey | PRUGCDFAHRGFDP-NYZIJIBMSA-N |
| XLogP | 3.34 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |