C21H26F3N3O4 — CID 171556950
6-[C-methyl-N-[(3Z,5Z)-3-methylocta-1,3,5-trien-4-yl]carbonimidoyl]-5-[6-(trifluoromethyl)pyrazin-2-yl]oxyoxane-3,4-diol (PubChem CID 171556950) has the molecular formula C21H26F3N3O4 and a molecular weight of 441.45 g/mol. Its IUPAC name is 6-[C-methyl-N-[(3Z,5Z)-3-methylocta-1,3,5-trien-4-yl]carbonimidoyl]-5-[6-(trifluoromethyl)pyrazin-2-yl]oxyoxane-3,4-diol.
| Compound Name | 6-[C-methyl-N-[(3Z,5Z)-3-methylocta-1,3,5-trien-4-yl]carbonimidoyl]-5-[6-(trifluoromethyl)pyrazin-2-yl]oxyoxane-3,4-diol |
|---|---|
| PubChem CID | 171556950 |
| Molecular Formula | C21H26F3N3O4 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 6-[C-methyl-N-[(3Z,5Z)-3-methylocta-1,3,5-trien-4-yl]carbonimidoyl]-5-[6-(trifluoromethyl)pyrazin-2-yl]oxyoxane-3,4-diol |
| SMILES | C=C/C(C)=C(/C=C\CC)\N=C(/C)C1OCC(O)C(O)C1Oc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C21H26F3N3O4/c1-5-7-8-14(12(3)6-2)26-13(4)19-20(18(29)15(28)11-30-19)31-17-10-25-9-16(27-17)21(22,23)24/h6-10,15,18-20,28-29H,2,5,11H2,1,3-4H3/b8-7-,14-12-,26-13+ |
| InChIKey | GASCQBTZQOTXTD-RFPFTEMXSA-N |
| XLogP | 3.25 |
| TPSA | 97.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|