C15H23F3N2O5 — CID 177015202
2-butan-2-yl-5-[6-(trifluoromethyl)pyrazin-2-yl]oxyoxane-3,4-diol;methanol (PubChem CID 177015202) has the molecular formula C15H23F3N2O5 and a molecular weight of 368.35 g/mol. Its IUPAC name is 2-butan-2-yl-5-[6-(trifluoromethyl)pyrazin-2-yl]oxyoxane-3,4-diol;methanol.
| Compound Name | 2-butan-2-yl-5-[6-(trifluoromethyl)pyrazin-2-yl]oxyoxane-3,4-diol;methanol |
|---|---|
| PubChem CID | 177015202 |
| Molecular Formula | C15H23F3N2O5 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 2-butan-2-yl-5-[6-(trifluoromethyl)pyrazin-2-yl]oxyoxane-3,4-diol;methanol |
| SMILES | CCC(C)C1OCC(Oc2cncc(C(F)(F)F)n2)C(O)C1O.CO |
| InChI | InChI=1S/C14H19F3N2O4.CH4O/c1-3-7(2)13-12(21)11(20)8(6-22-13)23-10-5-18-4-9(19-10)14(15,16)17;1-2/h4-5,7-8,11-13,20-21H,3,6H2,1-2H3;2H,1H3 |
| InChIKey | OISHYOQLWHANHC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |