C14H21F3N2O3 — CID 171557584
2-methyl-6-(trifluoromethyl)pyrazine;2-propan-2-yloxane-3,4-diol (PubChem CID 171557584) has the molecular formula C14H21F3N2O3 and a molecular weight of 322.33 g/mol. Its IUPAC name is 2-methyl-6-(trifluoromethyl)pyrazine;2-propan-2-yloxane-3,4-diol.
| Compound Name | 2-methyl-6-(trifluoromethyl)pyrazine;2-propan-2-yloxane-3,4-diol |
|---|---|
| PubChem CID | 171557584 |
| Molecular Formula | C14H21F3N2O3 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 2-methyl-6-(trifluoromethyl)pyrazine;2-propan-2-yloxane-3,4-diol |
| SMILES | CC(C)C1OCCC(O)C1O.Cc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H16O3.C6H5F3N2/c1-5(2)8-7(10)6(9)3-4-11-8;1-4-2-10-3-5(11-4)6(7,8)9/h5-10H,3-4H2,1-2H3;2-3H,1H3 |
| InChIKey | TYDKYILYEALOAB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |