C20H18F3N3O5 — CID 171557079
(2R,3R,4S,5R,6S)-2-methyl-6-(3-phenyl-1,2,4-oxadiazol-5-yl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol (PubChem CID 171557079) has the molecular formula C20H18F3N3O5 and a molecular weight of 437.37 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-methyl-6-(3-phenyl-1,2,4-oxadiazol-5-yl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol.
| Compound Name | (2R,3R,4S,5R,6S)-2-methyl-6-(3-phenyl-1,2,4-oxadiazol-5-yl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 171557079 |
| Molecular Formula | C20H18F3N3O5 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-methyl-6-(3-phenyl-1,2,4-oxadiazol-5-yl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
| SMILES | C[C@H]1O[C@H](c2nc(-c3ccccc3)no2)[C@H](Oc2cccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H18F3N3O5/c1-10-14(27)15(28)16(30-13-9-5-8-12(24-13)20(21,22)23)17(29-10)19-25-18(26-31-19)11-6-3-2-4-7-11/h2-10,14-17,27-28H,1H3/t10-,14+,15+,16-,17+/m1/s1 |
| InChIKey | PBLIEJMOOMECOW-BDNDHPQMSA-N |
| XLogP | 2.78 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |