C14H17F3N6O2 — CID 171557146
1-pyridazin-3-ylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171557146) has the molecular formula C14H17F3N6O2 and a molecular weight of 358.32 g/mol. Its IUPAC name is 1-pyridazin-3-ylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | 1-pyridazin-3-ylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171557146 |
| Molecular Formula | C14H17F3N6O2 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 1-pyridazin-3-ylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | Nc1cncc(C(F)(F)F)n1.OC1CCN(c2cccnn2)CC1O |
| InChI | InChI=1S/C9H13N3O2.C5H4F3N3/c13-7-3-5-12(6-8(7)14)9-2-1-4-10-11-9;6-5(7,8)3-1-10-2-4(9)11-3/h1-2,4,7-8,13-14H,3,5-6H2;1-2H,(H2,9,11) |
| InChIKey | LSXODJRJEUHUPY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |