C16H17F3N6O3 — CID 171557497
(2R,3R,4R)-2-[(pyridazin-3-ylamino)methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]iminomethyl]oxane-3,4-diol (PubChem CID 171557497) has the molecular formula C16H17F3N6O3 and a molecular weight of 398.35 g/mol. Its IUPAC name is (2R,3R,4R)-2-[(pyridazin-3-ylamino)methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]iminomethyl]oxane-3,4-diol.
| Compound Name | (2R,3R,4R)-2-[(pyridazin-3-ylamino)methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]iminomethyl]oxane-3,4-diol |
|---|---|
| PubChem CID | 171557497 |
| Molecular Formula | C16H17F3N6O3 |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | (2R,3R,4R)-2-[(pyridazin-3-ylamino)methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]iminomethyl]oxane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)C(/C=N/c2cncc(C(F)(F)F)n2)CO[C@@H]1CNc1cccnn1 |
| InChI | InChI=1S/C16H17F3N6O3/c17-16(18,19)11-6-20-7-13(24-11)21-4-9-8-28-10(15(27)14(9)26)5-22-12-2-1-3-23-25-12/h1-4,6-7,9-10,14-15,26-27H,5,8H2,(H,22,25)/b21-4+/t9?,10-,14-,15+/m1/s1 |
| InChIKey | UIJZIZIMHLCLLT-JTRPENIISA-N |
| XLogP | 0.84 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|