C15H18F3NO3 — CID 171557211
2-[[(3aR,4S,7aS)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl]oxy]-6-(trifluoromethyl)pyridine (PubChem CID 171557211) has the molecular formula C15H18F3NO3 and a molecular weight of 317.31 g/mol. Its IUPAC name is 2-[[(3aR,4S,7aS)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl]oxy]-6-(trifluoromethyl)pyridine.
| Compound Name | 2-[[(3aR,4S,7aS)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl]oxy]-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 171557211 |
| Molecular Formula | C15H18F3NO3 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-[[(3aR,4S,7aS)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl]oxy]-6-(trifluoromethyl)pyridine |
| SMILES | CC1(C)O[C@@H]2[C@@H](Oc3cccc(C(F)(F)F)n3)CCC[C@@H]2O1 |
| InChI | InChI=1S/C15H18F3NO3/c1-14(2)21-10-6-3-5-9(13(10)22-14)20-12-8-4-7-11(19-12)15(16,17)18/h4,7-10,13H,3,5-6H2,1-2H3/t9-,10-,13+/m0/s1 |
| InChIKey | GMNZVDQSCQDJIE-OUJBWJOFSA-N |
| XLogP | 3.55 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |