C23H27F3N4O5 — CID 171557292
benzyl 6-[(3S,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]piperidin-1-yl]-6-oxohexanoate (PubChem CID 171557292) has the molecular formula C23H27F3N4O5 and a molecular weight of 496.49 g/mol. Its IUPAC name is benzyl 6-[(3S,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]piperidin-1-yl]-6-oxohexanoate.
| Compound Name | benzyl 6-[(3S,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]piperidin-1-yl]-6-oxohexanoate |
|---|---|
| PubChem CID | 171557292 |
| Molecular Formula | C23H27F3N4O5 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | benzyl 6-[(3S,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]piperidin-1-yl]-6-oxohexanoate |
| SMILES | O=C(CCCCC(=O)N1C[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@@H](O)C1)OCc1ccccc1 |
| InChI | InChI=1S/C23H27F3N4O5/c24-23(25,26)18-10-27-11-19(29-18)28-16-12-30(13-17(31)22(16)34)20(32)8-4-5-9-21(33)35-14-15-6-2-1-3-7-15/h1-3,6-7,10-11,16-17,22,31,34H,4-5,8-9,12-14H2,(H,28,29)/t16-,17-,22+/m0/s1 |
| InChIKey | TUHMVXMXRVHPQN-PNLZDCPESA-N |
| XLogP | 2.14 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|