C21H19ClF3NO5 — CID 171557331
[(3aR,4S,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-(4-chlorophenyl)methanone (PubChem CID 171557331) has the molecular formula C21H19ClF3NO5 and a molecular weight of 457.83 g/mol. Its IUPAC name is [(3aR,4S,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-(4-chlorophenyl)methanone.
| Compound Name | [(3aR,4S,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 171557331 |
| Molecular Formula | C21H19ClF3NO5 |
| Molecular Weight | 457.83 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | [(3aR,4S,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-(4-chlorophenyl)methanone |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](Oc1cccc(C(F)(F)F)n1)CO[C@@H]2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19ClF3NO5/c1-20(2)30-17-13(29-15-5-3-4-14(26-15)21(23,24)25)10-28-18(19(17)31-20)16(27)11-6-8-12(22)9-7-11/h3-9,13,17-19H,10H2,1-2H3/t13-,17+,18+,19+/m0/s1 |
| InChIKey | CNWILESZFDKYJB-JGNHQEBTSA-N |
| XLogP | 4.30 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.83 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |