C22H22F3NO5 — CID 178008375
[(4R,6S,7R,7aR)-2,2,4-trimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]-phenylmethanone (PubChem CID 178008375) has the molecular formula C22H22F3NO5 and a molecular weight of 437.41 g/mol. Its IUPAC name is [(4R,6S,7R,7aR)-2,2,4-trimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]-phenylmethanone.
| Compound Name | [(4R,6S,7R,7aR)-2,2,4-trimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]-phenylmethanone |
|---|---|
| PubChem CID | 178008375 |
| Molecular Formula | C22H22F3NO5 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | [(4R,6S,7R,7aR)-2,2,4-trimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]-phenylmethanone |
| SMILES | C[C@H]1O[C@H](C(=O)c2ccccc2)[C@H](Oc2cccc(C(F)(F)F)n2)[C@H]2OC(C)(C)OC12 |
| InChI | InChI=1S/C22H22F3NO5/c1-12-17-20(31-21(2,3)30-17)19(18(28-12)16(27)13-8-5-4-6-9-13)29-15-11-7-10-14(26-15)22(23,24)25/h4-12,17-20H,1-3H3/t12-,17?,18-,19+,20+/m1/s1 |
| InChIKey | YIXAOUMVXSCCRA-ZYNDEEBMSA-N |
| XLogP | 4.04 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |