C24H22FNO4 — CID 59637659
propan-2-yl 2-[3-[2-[6-(3-fluorophenyl)-2-pyridinyl]-2-oxoethyl]phenoxy]acetate (PubChem CID 59637659) has the molecular formula C24H22FNO4 and a molecular weight of 407.44 g/mol. Its IUPAC name is propan-2-yl 2-[3-[2-[6-(3-fluorophenyl)-2-pyridinyl]-2-oxoethyl]phenoxy]acetate.
| Compound Name | propan-2-yl 2-[3-[2-[6-(3-fluorophenyl)-2-pyridinyl]-2-oxoethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 59637659 |
| Molecular Formula | C24H22FNO4 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | propan-2-yl 2-[3-[2-[6-(3-fluorophenyl)-2-pyridinyl]-2-oxoethyl]phenoxy]acetate |
| SMILES | CC(C)OC(=O)COc1cccc(CC(=O)c2cccc(-c3cccc(F)c3)n2)c1 |
| InChI | InChI=1S/C24H22FNO4/c1-16(2)30-24(28)15-29-20-9-3-6-17(12-20)13-23(27)22-11-5-10-21(26-22)18-7-4-8-19(25)14-18/h3-12,14,16H,13,15H2,1-2H3 |
| InChIKey | DDDLPLYGWYIPJJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |