C27H28LiNO5 — CID 23672807
lithium 3-[2-[6-[(E)-3-(3-butoxyphenyl)-3-hydroxyprop-1-enyl]-2-pyridinyl]-1-hydroxyethyl]benzoate (PubChem CID 23672807) has the molecular formula C27H28LiNO5 and a molecular weight of 453.46 g/mol. Its IUPAC name is lithium 3-[2-[6-[(E)-3-(3-butoxyphenyl)-3-hydroxyprop-1-enyl]-2-pyridinyl]-1-hydroxyethyl]benzoate.
| Compound Name | lithium 3-[2-[6-[(E)-3-(3-butoxyphenyl)-3-hydroxyprop-1-enyl]-2-pyridinyl]-1-hydroxyethyl]benzoate |
|---|---|
| PubChem CID | 23672807 |
| Molecular Formula | C27H28LiNO5 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | lithium 3-[2-[6-[(E)-3-(3-butoxyphenyl)-3-hydroxyprop-1-enyl]-2-pyridinyl]-1-hydroxyethyl]benzoate |
| SMILES | CCCCOc1cccc(C(O)/C=C/c2cccc(CC(O)c3cccc(C(=O)[O-])c3)n2)c1.[Li+] |
| InChI | InChI=1S/C27H29NO5.Li/c1-2-3-15-33-24-12-5-8-20(17-24)25(29)14-13-22-10-6-11-23(28-22)18-26(30)19-7-4-9-21(16-19)27(31)32;/h4-14,16-17,25-26,29-30H,2-3,15,18H2,1H3,(H,31,32);/q;+1/p-1/b14-13+; |
| InChIKey | SEEULXRNAVVAIE-IERUDJENSA-M |
| XLogP | 0.65 |
| TPSA | 102.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|