C19H22F3NO7 — CID 171556570
dimethyl (3aS,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5,5-dicarboxylate (PubChem CID 171556570) has the molecular formula C19H22F3NO7 and a molecular weight of 433.38 g/mol. Its IUPAC name is dimethyl (3aS,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5,5-dicarboxylate.
| Compound Name | dimethyl (3aS,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5,5-dicarboxylate |
|---|---|
| PubChem CID | 171556570 |
| Molecular Formula | C19H22F3NO7 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | dimethyl (3aS,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5,5-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](Oc2cccc(C(F)(F)F)n2)[C@H]2OC(C)(C)O[C@H]2C1 |
| InChI | InChI=1S/C19H22F3NO7/c1-17(2)29-11-9-18(15(24)26-3,16(25)27-4)8-10(14(11)30-17)28-13-7-5-6-12(23-13)19(20,21)22/h5-7,10-11,14H,8-9H2,1-4H3/t10-,11-,14+/m0/s1 |
| InChIKey | BCYOITUFYUDFOT-COPLHBTASA-N |
| XLogP | 2.49 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|