C17H20F3NO5 — CID 171556954
methyl (3aS,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxylate (PubChem CID 171556954) has the molecular formula C17H20F3NO5 and a molecular weight of 375.34 g/mol. Its IUPAC name is methyl (3aS,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl (3aS,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 171556954 |
| Molecular Formula | C17H20F3NO5 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | methyl (3aS,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)C1C[C@H](Oc2cccc(C(F)(F)F)n2)[C@H]2OC(C)(C)O[C@H]2C1 |
| InChI | InChI=1S/C17H20F3NO5/c1-16(2)25-11-8-9(15(22)23-3)7-10(14(11)26-16)24-13-6-4-5-12(21-13)17(18,19)20/h4-6,9-11,14H,7-8H2,1-3H3/t9?,10-,11-,14+/m0/s1 |
| InChIKey | TYRUSEVTXMOELH-WHYLROFESA-N |
| XLogP | 2.95 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |