C16H18F3NO5 — CID 171557938
(3aS,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxylic acid (PubChem CID 171557938) has the molecular formula C16H18F3NO5 and a molecular weight of 361.32 g/mol. Its IUPAC name is (3aS,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxylic acid.
| Compound Name | (3aS,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxylic acid |
|---|---|
| PubChem CID | 171557938 |
| Molecular Formula | C16H18F3NO5 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (3aS,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxylic acid |
| SMILES | CC1(C)O[C@@H]2[C@@H](Oc3cccc(C(F)(F)F)n3)CC(C(=O)O)C[C@@H]2O1 |
| InChI | InChI=1S/C16H18F3NO5/c1-15(2)24-10-7-8(14(21)22)6-9(13(10)25-15)23-12-5-3-4-11(20-12)16(17,18)19/h3-5,8-10,13H,6-7H2,1-2H3,(H,21,22)/t8?,9-,10-,13+/m0/s1 |
| InChIKey | LGMDFASSQZTXBS-QHCIETMLSA-N |
| XLogP | 2.86 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |