C12H12F3N3O3 — CID 171557531
(2R,3R,4R,5S)-2-ethynyl-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 171557531) has the molecular formula C12H12F3N3O3 and a molecular weight of 303.24 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-ethynyl-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-ethynyl-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 171557531 |
| Molecular Formula | C12H12F3N3O3 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (2R,3R,4R,5S)-2-ethynyl-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | C#C[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H12F3N3O3/c1-2-7-11(20)10(19)6(5-21-7)17-9-4-16-3-8(18-9)12(13,14)15/h1,3-4,6-7,10-11,19-20H,5H2,(H,17,18)/t6-,7+,10+,11-/m0/s1 |
| InChIKey | JANRKXAXLXEQRG-HJGGDWJDSA-N |
| XLogP | 0.03 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|