C27H28F3N3O4 — CID 171557581
1-[4-[[3-[(2R,3R,4R,5S)-4,5-dihydroxy-3-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]phenyl]methyl]phenyl]-2-methylpropan-1-one (PubChem CID 171557581) has the molecular formula C27H28F3N3O4 and a molecular weight of 515.53 g/mol. Its IUPAC name is 1-[4-[[3-[(2R,3R,4R,5S)-4,5-dihydroxy-3-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]phenyl]methyl]phenyl]-2-methylpropan-1-one.
| Compound Name | 1-[4-[[3-[(2R,3R,4R,5S)-4,5-dihydroxy-3-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]phenyl]methyl]phenyl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 171557581 |
| Molecular Formula | C27H28F3N3O4 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 1-[4-[[3-[(2R,3R,4R,5S)-4,5-dihydroxy-3-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]phenyl]methyl]phenyl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)c1ccc(Cc2cccc([C@H]3OC[C@H](O)[C@H](O)[C@H]3Nc3cncc(C(F)(F)F)n3)c2)cc1 |
| InChI | InChI=1S/C27H28F3N3O4/c1-15(2)24(35)18-8-6-16(7-9-18)10-17-4-3-5-19(11-17)26-23(25(36)20(34)14-37-26)33-22-13-31-12-21(32-22)27(28,29)30/h3-9,11-13,15,20,23,25-26,34,36H,10,14H2,1-2H3,(H,32,33)/t20-,23+,25-,26+/m0/s1 |
| InChIKey | WXHGYALAFIVTPP-KRWYSWARSA-N |
| XLogP | 4.20 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |