C17H20FN3O4 — CID 171556583
(2R,3R,4R,5R,6S)-5-[[6-(fluoromethyl)pyrazin-2-yl]amino]-2-(hydroxymethyl)-6-phenyloxane-3,4-diol (PubChem CID 171556583) has the molecular formula C17H20FN3O4 and a molecular weight of 349.36 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-5-[[6-(fluoromethyl)pyrazin-2-yl]amino]-2-(hydroxymethyl)-6-phenyloxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6S)-5-[[6-(fluoromethyl)pyrazin-2-yl]amino]-2-(hydroxymethyl)-6-phenyloxane-3,4-diol |
|---|---|
| PubChem CID | 171556583 |
| Molecular Formula | C17H20FN3O4 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (2R,3R,4R,5R,6S)-5-[[6-(fluoromethyl)pyrazin-2-yl]amino]-2-(hydroxymethyl)-6-phenyloxane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](c2ccccc2)[C@H](Nc2cncc(CF)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H20FN3O4/c18-6-11-7-19-8-13(20-11)21-14-16(24)15(23)12(9-22)25-17(14)10-4-2-1-3-5-10/h1-5,7-8,12,14-17,22-24H,6,9H2,(H,20,21)/t12-,14-,15+,16-,17+/m1/s1 |
| InChIKey | HKVZJIUIKPITLK-CMZRPVNOSA-N |
| XLogP | 0.58 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |