C16H15F4N3O4 — CID 171557669
(2R,3R,4S,5R,6S)-6-(5-fluoropyrimidin-4-yl)-2-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol (PubChem CID 171557669) has the molecular formula C16H15F4N3O4 and a molecular weight of 389.31 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-6-(5-fluoropyrimidin-4-yl)-2-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol.
| Compound Name | (2R,3R,4S,5R,6S)-6-(5-fluoropyrimidin-4-yl)-2-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 171557669 |
| Molecular Formula | C16H15F4N3O4 |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | (2R,3R,4S,5R,6S)-6-(5-fluoropyrimidin-4-yl)-2-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
| SMILES | C[C@H]1O[C@@H](c2ncncc2F)[C@H](Oc2cccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H15F4N3O4/c1-7-12(24)13(25)15(14(26-7)11-8(17)5-21-6-22-11)27-10-4-2-3-9(23-10)16(18,19)20/h2-7,12-15,24-25H,1H3/t7-,12+,13+,14+,15-/m1/s1 |
| InChIKey | JWPUWDVZJISYJA-AMQDTVPESA-N |
| XLogP | 1.66 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |