C18H18F3N7O4 — CID 171557719
N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-7H-pyrrolo[2,3-d]pyrimidine-2-carboxamide (PubChem CID 171557719) has the molecular formula C18H18F3N7O4 and a molecular weight of 453.38 g/mol. Its IUPAC name is N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-7H-pyrrolo[2,3-d]pyrimidine-2-carboxamide.
| Compound Name | N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-7H-pyrrolo[2,3-d]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 171557719 |
| Molecular Formula | C18H18F3N7O4 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-7H-pyrrolo[2,3-d]pyrimidine-2-carboxamide |
| SMILES | O=C(NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O)c1ncc2cc[nH]c2n1 |
| InChI | InChI=1S/C18H18F3N7O4/c19-18(20,21)11-5-22-6-12(27-11)26-9-7-32-10(14(30)13(9)29)4-25-17(31)16-24-3-8-1-2-23-15(8)28-16/h1-3,5-6,9-10,13-14,29-30H,4,7H2,(H,25,31)(H,26,27)(H,23,24,28)/t9-,10+,13+,14-/m0/s1 |
| InChIKey | UKHQSVUUTHOJLX-PJQZNRQZSA-N |
| XLogP | 0.10 |
| TPSA | 158.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |