C16H17F3N2O4 — CID 171557805
(3aS,4R,6R,7S,7aR)-2,2,4-trimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-carbonitrile (PubChem CID 171557805) has the molecular formula C16H17F3N2O4 and a molecular weight of 358.32 g/mol. Its IUPAC name is (3aS,4R,6R,7S,7aR)-2,2,4-trimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-carbonitrile.
| Compound Name | (3aS,4R,6R,7S,7aR)-2,2,4-trimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-carbonitrile |
|---|---|
| PubChem CID | 171557805 |
| Molecular Formula | C16H17F3N2O4 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (3aS,4R,6R,7S,7aR)-2,2,4-trimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-carbonitrile |
| SMILES | C[C@H]1O[C@H](C#N)[C@H](Oc2cccc(C(F)(F)F)n2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C16H17F3N2O4/c1-8-12-14(25-15(2,3)24-12)13(9(7-20)22-8)23-11-6-4-5-10(21-11)16(17,18)19/h4-6,8-9,12-14H,1-3H3/t8-,9-,12+,13+,14+/m1/s1 |
| InChIKey | PAXIXLIWNMCFNO-IZPVPAKOSA-N |
| XLogP | 2.68 |
| TPSA | 73.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |