C19H24F3N5O4 — CID 171558094
(2R,3R,4S,5R,6R)-2-methyl-6-(1-piperidin-4-yltriazol-4-yl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol (PubChem CID 171558094) has the molecular formula C19H24F3N5O4 and a molecular weight of 443.43 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-methyl-6-(1-piperidin-4-yltriazol-4-yl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol.
| Compound Name | (2R,3R,4S,5R,6R)-2-methyl-6-(1-piperidin-4-yltriazol-4-yl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 171558094 |
| Molecular Formula | C19H24F3N5O4 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-methyl-6-(1-piperidin-4-yltriazol-4-yl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
| SMILES | C[C@H]1O[C@H](c2cn(C3CCNCC3)nn2)[C@H](Oc2cccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H24F3N5O4/c1-10-15(28)16(29)18(31-14-4-2-3-13(24-14)19(20,21)22)17(30-10)12-9-27(26-25-12)11-5-7-23-8-6-11/h2-4,9-11,15-18,23,28-29H,5-8H2,1H3/t10-,15+,16+,17-,18-/m1/s1 |
| InChIKey | WPAOUXAJXGQQJN-SLEMLFNQSA-N |
| XLogP | 1.25 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |