C19H23F3N2O4 — CID 171558200
6-[(2E,4Z)-5-ethylhepta-2,4,6-trien-2-yl]-5-[6-(trifluoromethyl)pyrazin-2-yl]oxyoxane-3,4-diol (PubChem CID 171558200) has the molecular formula C19H23F3N2O4 and a molecular weight of 400.40 g/mol. Its IUPAC name is 6-[(2E,4Z)-5-ethylhepta-2,4,6-trien-2-yl]-5-[6-(trifluoromethyl)pyrazin-2-yl]oxyoxane-3,4-diol.
| Compound Name | 6-[(2E,4Z)-5-ethylhepta-2,4,6-trien-2-yl]-5-[6-(trifluoromethyl)pyrazin-2-yl]oxyoxane-3,4-diol |
|---|---|
| PubChem CID | 171558200 |
| Molecular Formula | C19H23F3N2O4 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 6-[(2E,4Z)-5-ethylhepta-2,4,6-trien-2-yl]-5-[6-(trifluoromethyl)pyrazin-2-yl]oxyoxane-3,4-diol |
| SMILES | C=C/C(=C\C=C(/C)C1OCC(O)C(O)C1Oc1cncc(C(F)(F)F)n1)CC |
| InChI | InChI=1S/C19H23F3N2O4/c1-4-12(5-2)7-6-11(3)17-18(16(26)13(25)10-27-17)28-15-9-23-8-14(24-15)19(20,21)22/h4,6-9,13,16-18,25-26H,1,5,10H2,2-3H3/b11-6+,12-7+ |
| InChIKey | RQGFJLKHNQLFHN-GNXRPPCSSA-N |
| XLogP | 2.83 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|