C16H22F3NO5 — CID 171558350
2-[(2S,3S,4S,5S)-2-(hydroxymethyl)-3-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-4-yl]oxypropan-2-ol (PubChem CID 171558350) has the molecular formula C16H22F3NO5 and a molecular weight of 365.35 g/mol. Its IUPAC name is 2-[(2S,3S,4S,5S)-2-(hydroxymethyl)-3-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-4-yl]oxypropan-2-ol.
| Compound Name | 2-[(2S,3S,4S,5S)-2-(hydroxymethyl)-3-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-4-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 171558350 |
| Molecular Formula | C16H22F3NO5 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-[(2S,3S,4S,5S)-2-(hydroxymethyl)-3-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-4-yl]oxypropan-2-ol |
| SMILES | C[C@@H]1[C@H](OC(C)(C)O)[C@@H](Oc2cccc(C(F)(F)F)n2)CO[C@@H]1CO |
| InChI | InChI=1S/C16H22F3NO5/c1-9-10(7-21)23-8-11(14(9)25-15(2,3)22)24-13-6-4-5-12(20-13)16(17,18)19/h4-6,9-11,14,21-22H,7-8H2,1-3H3/t9-,10+,11-,14-/m0/s1 |
| InChIKey | VZRHUDVBYHLQFQ-MIJXAVMKSA-N |
| XLogP | 1.99 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|