C24H24F3N3O6 — CID 171558634
(2R,3R,4R,5S)-2-[[4-[4-(dihydroxymethyl)phenyl]phenoxy]methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 171558634) has the molecular formula C24H24F3N3O6 and a molecular weight of 507.47 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-[[4-[4-(dihydroxymethyl)phenyl]phenoxy]methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-[[4-[4-(dihydroxymethyl)phenyl]phenoxy]methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 171558634 |
| Molecular Formula | C24H24F3N3O6 |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | (2R,3R,4R,5S)-2-[[4-[4-(dihydroxymethyl)phenyl]phenoxy]methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | OC(O)c1ccc(-c2ccc(OC[C@H]3OC[C@H](Nc4cncc(C(F)(F)F)n4)[C@@H](O)[C@H]3O)cc2)cc1 |
| InChI | InChI=1S/C24H24F3N3O6/c25-24(26,27)19-9-28-10-20(30-19)29-17-11-36-18(22(32)21(17)31)12-35-16-7-5-14(6-8-16)13-1-3-15(4-2-13)23(33)34/h1-10,17-18,21-23,31-34H,11-12H2,(H,29,30)/t17-,18+,21+,22-/m0/s1 |
| InChIKey | WYVAZESKRWDWST-KKXYHZGYSA-N |
| XLogP | 2.13 |
| TPSA | 137.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|