C23H32F3N3O4S — CID 171558696
2,2-dimethyl-4-[(4-methylphenyl)sulfanyloxymethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran;ethane;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171558696) has the molecular formula C23H32F3N3O4S and a molecular weight of 503.59 g/mol. Its IUPAC name is 2,2-dimethyl-4-[(4-methylphenyl)sulfanyloxymethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran;ethane;6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | 2,2-dimethyl-4-[(4-methylphenyl)sulfanyloxymethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran;ethane;6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171558696 |
| Molecular Formula | C23H32F3N3O4S |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 2,2-dimethyl-4-[(4-methylphenyl)sulfanyloxymethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran;ethane;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CC.Cc1ccc(SOCC2OCCC3OC(C)(C)OC23)cc1.Nc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C16H22O4S.C5H4F3N3.C2H6/c1-11-4-6-12(7-5-11)21-18-10-14-15-13(8-9-17-14)19-16(2,3)20-15;6-5(7,8)3-1-10-2-4(9)11-3;1-2/h4-7,13-15H,8-10H2,1-3H3;1-2H,(H2,9,11);1-2H3 |
| InChIKey | CVLBCSQNFOYSNF-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|