C20H25F3N4O3S — CID 171557402
1-(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)-N-phenylsulfanylmethanamine;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171557402) has the molecular formula C20H25F3N4O3S and a molecular weight of 458.51 g/mol. Its IUPAC name is 1-(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)-N-phenylsulfanylmethanamine;6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | 1-(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)-N-phenylsulfanylmethanamine;6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171557402 |
| Molecular Formula | C20H25F3N4O3S |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 1-(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)-N-phenylsulfanylmethanamine;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CC1(C)OC2CCOC(CNSc3ccccc3)C2O1.Nc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H21NO3S.C5H4F3N3/c1-15(2)18-12-8-9-17-13(14(12)19-15)10-16-20-11-6-4-3-5-7-11;6-5(7,8)3-1-10-2-4(9)11-3/h3-7,12-14,16H,8-10H2,1-2H3;1-2H,(H2,9,11) |
| InChIKey | SWHOBLYJBWSHER-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|