C21H31F3N4O3S — CID 177015781
2-methylpropane;2-[(phenylsulfanylamino)methyl]oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 177015781) has the molecular formula C21H31F3N4O3S and a molecular weight of 476.57 g/mol. Its IUPAC name is 2-methylpropane;2-[(phenylsulfanylamino)methyl]oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | 2-methylpropane;2-[(phenylsulfanylamino)methyl]oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 177015781 |
| Molecular Formula | C21H31F3N4O3S |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 2-methylpropane;2-[(phenylsulfanylamino)methyl]oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CC(C)C.Nc1cncc(C(F)(F)F)n1.OC1CCOC(CNSc2ccccc2)C1O |
| InChI | InChI=1S/C12H17NO3S.C5H4F3N3.C4H10/c14-10-6-7-16-11(12(10)15)8-13-17-9-4-2-1-3-5-9;6-5(7,8)3-1-10-2-4(9)11-3;1-4(2)3/h1-5,10-15H,6-8H2;1-2H,(H2,9,11);4H,1-3H3 |
| InChIKey | ZPNQEHUZJAAIHK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|