C15H17F3N6O4 — CID 171558719
N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-1H-imidazole-2-carboxamide (PubChem CID 171558719) has the molecular formula C15H17F3N6O4 and a molecular weight of 402.33 g/mol. Its IUPAC name is N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-1H-imidazole-2-carboxamide.
| Compound Name | N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 171558719 |
| Molecular Formula | C15H17F3N6O4 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-1H-imidazole-2-carboxamide |
| SMILES | O=C(NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O)c1ncc[nH]1 |
| InChI | InChI=1S/C15H17F3N6O4/c16-15(17,18)9-4-19-5-10(24-9)23-7-6-28-8(12(26)11(7)25)3-22-14(27)13-20-1-2-21-13/h1-2,4-5,7-8,11-12,25-26H,3,6H2,(H,20,21)(H,22,27)(H,23,24)/t7-,8+,11+,12-/m0/s1 |
| InChIKey | SALRPPVLVWGOSR-MDSNHJATSA-N |
| XLogP | -0.45 |
| TPSA | 145.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |