C19H12F5N3O3 — CID 171559424
N-[5,7-bis(difluoromethoxy)-1-prop-2-ynylindazol-3-yl]-4-fluorobenzamide (PubChem CID 171559424) has the molecular formula C19H12F5N3O3 and a molecular weight of 425.31 g/mol. Its IUPAC name is N-[5,7-bis(difluoromethoxy)-1-prop-2-ynylindazol-3-yl]-4-fluorobenzamide.
| Compound Name | N-[5,7-bis(difluoromethoxy)-1-prop-2-ynylindazol-3-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 171559424 |
| Molecular Formula | C19H12F5N3O3 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | N-[5,7-bis(difluoromethoxy)-1-prop-2-ynylindazol-3-yl]-4-fluorobenzamide |
| SMILES | C#CCn1nc(NC(=O)c2ccc(F)cc2)c2cc(OC(F)F)cc(OC(F)F)c21 |
| InChI | InChI=1S/C19H12F5N3O3/c1-2-7-27-15-13(8-12(29-18(21)22)9-14(15)30-19(23)24)16(26-27)25-17(28)10-3-5-11(20)6-4-10/h1,3-6,8-9,18-19H,7H2,(H,25,26,28) |
| InChIKey | NLPVMPXXKMLQBF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|