C20H19F2N3O — CID 171559435
N-[7-cyclopropyl-1-(3-fluoropropyl)indazol-3-yl]-4-fluorobenzamide (PubChem CID 171559435) has the molecular formula C20H19F2N3O and a molecular weight of 355.39 g/mol. Its IUPAC name is N-[7-cyclopropyl-1-(3-fluoropropyl)indazol-3-yl]-4-fluorobenzamide.
| Compound Name | N-[7-cyclopropyl-1-(3-fluoropropyl)indazol-3-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 171559435 |
| Molecular Formula | C20H19F2N3O |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[7-cyclopropyl-1-(3-fluoropropyl)indazol-3-yl]-4-fluorobenzamide |
| SMILES | O=C(Nc1nn(CCCF)c2c(C3CC3)cccc12)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H19F2N3O/c21-11-2-12-25-18-16(13-5-6-13)3-1-4-17(18)19(24-25)23-20(26)14-7-9-15(22)10-8-14/h1,3-4,7-10,13H,2,5-6,11-12H2,(H,23,24,26) |
| InChIKey | DNBNJULFWGYVOF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |