About N-(4-cyclopropyl-1-ethyl-5-methylpyrazol-3-yl)-3,4-difluorobenzamide
N-(4-cyclopropyl-1-ethyl-5-methylpyrazol-3-yl)-3,4-difluorobenzamide (PubChem CID 169169704) has the molecular formula C16H17F2N3O
and a molecular weight of 305.33 g/mol. Its IUPAC name is N-(4-cyclopropyl-1-ethyl-5-methylpyrazol-3-yl)-3,4-difluorobenzamide.
Molecular Properties
| Compound Name | N-(4-cyclopropyl-1-ethyl-5-methylpyrazol-3-yl)-3,4-difluorobenzamide |
| PubChem CID | 169169704 |
| Molecular Formula | C16H17F2N3O |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-(4-cyclopropyl-1-ethyl-5-methylpyrazol-3-yl)-3,4-difluorobenzamide |
| SMILES | CCn1nc(NC(=O)c2ccc(F)c(F)c2)c(C2CC2)c1C |
| InChI | InChI=1S/C16H17F2N3O/c1-3-21-9(2)14(10-4-5-10)15(20-21)19-16(22)11-6-7-12(17)13(18)8-11/h6-8,10H,3-5H2,1-2H3,(H,19,20,22) |
| InChIKey | XVYUCBHDCBKYCO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-cyclopropyl-1-ethyl-5-methylpyrazol-3-yl)-3,4-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyclopropyl-1-ethyl-5-methylpyrazol-3-yl)-3,4-difluorobenzamide?
The IUPAC name of N-(4-cyclopropyl-1-ethyl-5-methylpyrazol-3-yl)-3,4-difluorobenzamide (CID 169169704) is N-(4-cyclopropyl-1-ethyl-5-methylpyrazol-3-yl)-3,4-difluorobenzamide.
What is the SMILES notation for N-(4-cyclopropyl-1-ethyl-5-methylpyrazol-3-yl)-3,4-difluorobenzamide?
The canonical SMILES for N-(4-cyclopropyl-1-ethyl-5-methylpyrazol-3-yl)-3,4-difluorobenzamide is CCn1nc(NC(=O)c2ccc(F)c(F)c2)c(C2CC2)c1C.
What is the InChIKey of N-(4-cyclopropyl-1-ethyl-5-methylpyrazol-3-yl)-3,4-difluorobenzamide?
The InChIKey is XVYUCBHDCBKYCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F2N3O/c1-3-21-9(2)14(10-4-5-10)15(20-21)19-16(22)11-6-7-12(17)13(18)8-11/h6-8,10H,3-5H2,1-2H3,(H,19,20,22).
What are the key properties of N-(4-cyclopropyl-1-ethyl-5-methylpyrazol-3-yl)-3,4-difluorobenzamide?
N-(4-cyclopropyl-1-ethyl-5-methylpyrazol-3-yl)-3,4-difluorobenzamide has a molecular weight of 305.33 g/mol, XLogP of 3.62, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyclopropyl-1-ethyl-5-methylpyrazol-3-yl)-3,4-difluorobenzamide is sourced from PubChem (CID 169169704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).