C21H30N5O2Pd- — CID 171560989
[1-[2-(4-aminobutoxy)-2-methylpropyl]-2-(ethoxymethyl)imidazo[4,5-c]quinolin-4-yl]azanide;palladium (PubChem CID 171560989) has the molecular formula C21H30N5O2Pd- and a molecular weight of 490.92 g/mol. Its IUPAC name is [1-[2-(4-aminobutoxy)-2-methylpropyl]-2-(ethoxymethyl)imidazo[4,5-c]quinolin-4-yl]azanide;palladium.
| Compound Name | [1-[2-(4-aminobutoxy)-2-methylpropyl]-2-(ethoxymethyl)imidazo[4,5-c]quinolin-4-yl]azanide;palladium |
|---|---|
| PubChem CID | 171560989 |
| Molecular Formula | C21H30N5O2Pd- |
| Molecular Weight | 490.92 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | [1-[2-(4-aminobutoxy)-2-methylpropyl]-2-(ethoxymethyl)imidazo[4,5-c]quinolin-4-yl]azanide;palladium |
| SMILES | CCOCc1nc2c([NH-])nc3ccccc3c2n1CC(C)(C)OCCCCN.[Pd] |
| InChI | InChI=1S/C21H30N5O2.Pd/c1-4-27-13-17-25-18-19(15-9-5-6-10-16(15)24-20(18)23)26(17)14-21(2,3)28-12-8-7-11-22;/h5-6,9-10H,4,7-8,11-14,22H2,1-3H3,(H-,23,24);/q-1; |
| InChIKey | LQDXAOGKDHNPPN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.92 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|