C19H25NO4 — CID 171562463
ethane;2-(3-hydroxy-5-methyl-4-phenylmethoxyphenyl)-2-(methylamino)acetic acid (PubChem CID 171562463) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is ethane;2-(3-hydroxy-5-methyl-4-phenylmethoxyphenyl)-2-(methylamino)acetic acid.
| Compound Name | ethane;2-(3-hydroxy-5-methyl-4-phenylmethoxyphenyl)-2-(methylamino)acetic acid |
|---|---|
| PubChem CID | 171562463 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | ethane;2-(3-hydroxy-5-methyl-4-phenylmethoxyphenyl)-2-(methylamino)acetic acid |
| SMILES | CC.CNC(C(=O)O)c1cc(C)c(OCc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C17H19NO4.C2H6/c1-11-8-13(15(18-2)17(20)21)9-14(19)16(11)22-10-12-6-4-3-5-7-12;1-2/h3-9,15,18-19H,10H2,1-2H3,(H,20,21);1-2H3 |
| InChIKey | UCEDHQKHSSKNSV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |