About pentadecan-7-yl 6-[3-[3-(dimethylamino)propanoyloxy]pyrrolidin-1-yl]hexanoate
pentadecan-7-yl 6-[3-[3-(dimethylamino)propanoyloxy]pyrrolidin-1-yl]hexanoate (PubChem CID 171562654) has the molecular formula C30H58N2O4
and a molecular weight of 510.80 g/mol. Its IUPAC name is pentadecan-7-yl 6-[3-[3-(dimethylamino)propanoyloxy]pyrrolidin-1-yl]hexanoate.
Molecular Properties
| Compound Name | pentadecan-7-yl 6-[3-[3-(dimethylamino)propanoyloxy]pyrrolidin-1-yl]hexanoate |
| PubChem CID | 171562654 |
| Molecular Formula | C30H58N2O4 |
| Molecular Weight | 510.80 g/mol |
| Exact Mass | 510.44 |
| IUPAC Name | pentadecan-7-yl 6-[3-[3-(dimethylamino)propanoyloxy]pyrrolidin-1-yl]hexanoate |
| SMILES | CCCCCCCCC(CCCCCC)OC(=O)CCCCCN1CCC(OC(=O)CCN(C)C)C1 |
| InChI | InChI=1S/C30H58N2O4/c1-5-7-9-11-12-15-19-27(18-14-10-8-6-2)35-29(33)20-16-13-17-23-32-25-21-28(26-32)36-30(34)22-24-31(3)4/h27-28H,5-26H2,1-4H3 |
| InChIKey | SGAODFXQZHRYKN-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.80 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pentadecan-7-yl 6-[3-[3-(dimethylamino)propanoyloxy]pyrrolidin-1-yl]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentadecan-7-yl 6-[3-[3-(dimethylamino)propanoyloxy]pyrrolidin-1-yl]hexanoate?
The IUPAC name of pentadecan-7-yl 6-[3-[3-(dimethylamino)propanoyloxy]pyrrolidin-1-yl]hexanoate (CID 171562654) is pentadecan-7-yl 6-[3-[3-(dimethylamino)propanoyloxy]pyrrolidin-1-yl]hexanoate.
What is the SMILES notation for pentadecan-7-yl 6-[3-[3-(dimethylamino)propanoyloxy]pyrrolidin-1-yl]hexanoate?
The canonical SMILES for pentadecan-7-yl 6-[3-[3-(dimethylamino)propanoyloxy]pyrrolidin-1-yl]hexanoate is CCCCCCCCC(CCCCCC)OC(=O)CCCCCN1CCC(OC(=O)CCN(C)C)C1.
What is the InChIKey of pentadecan-7-yl 6-[3-[3-(dimethylamino)propanoyloxy]pyrrolidin-1-yl]hexanoate?
The InChIKey is SGAODFXQZHRYKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H58N2O4/c1-5-7-9-11-12-15-19-27(18-14-10-8-6-2)35-29(33)20-16-13-17-23-32-25-21-28(26-32)36-30(34)22-24-31(3)4/h27-28H,5-26H2,1-4H3.
What are the key properties of pentadecan-7-yl 6-[3-[3-(dimethylamino)propanoyloxy]pyrrolidin-1-yl]hexanoate?
pentadecan-7-yl 6-[3-[3-(dimethylamino)propanoyloxy]pyrrolidin-1-yl]hexanoate has a molecular weight of 510.80 g/mol, XLogP of 6.75, 23 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pentadecan-7-yl 6-[3-[3-(dimethylamino)propanoyloxy]pyrrolidin-1-yl]hexanoate is sourced from PubChem (CID 171562654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).