About ethane;ethene;5-methyl-N'-(propan-2-ylideneamino)pyridine-2-carboximidamide
ethane;ethene;5-methyl-N'-(propan-2-ylideneamino)pyridine-2-carboximidamide (PubChem CID 171564528) has the molecular formula C14H24N4
and a molecular weight of 248.37 g/mol. Its IUPAC name is ethane;ethene;5-methyl-N'-(propan-2-ylideneamino)pyridine-2-carboximidamide.
Molecular Properties
| Compound Name | ethane;ethene;5-methyl-N'-(propan-2-ylideneamino)pyridine-2-carboximidamide |
| PubChem CID | 171564528 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | ethane;ethene;5-methyl-N'-(propan-2-ylideneamino)pyridine-2-carboximidamide |
| SMILES | C=C.CC.CC(C)=N/N=C(\N)c1ccc(C)cn1 |
| InChI | InChI=1S/C10H14N4.C2H6.C2H4/c1-7(2)13-14-10(11)9-5-4-8(3)6-12-9;2*1-2/h4-6H,1-3H3,(H2,11,14);1-2H3;1-2H2 |
| InChIKey | NEBBUQSNLGZXCQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethene;5-methyl-N'-(propan-2-ylideneamino)pyridine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethene;5-methyl-N'-(propan-2-ylideneamino)pyridine-2-carboximidamide?
The IUPAC name of ethane;ethene;5-methyl-N'-(propan-2-ylideneamino)pyridine-2-carboximidamide (CID 171564528) is ethane;ethene;5-methyl-N'-(propan-2-ylideneamino)pyridine-2-carboximidamide.
What is the SMILES notation for ethane;ethene;5-methyl-N'-(propan-2-ylideneamino)pyridine-2-carboximidamide?
The canonical SMILES for ethane;ethene;5-methyl-N'-(propan-2-ylideneamino)pyridine-2-carboximidamide is C=C.CC.CC(C)=N/N=C(\N)c1ccc(C)cn1.
What is the InChIKey of ethane;ethene;5-methyl-N'-(propan-2-ylideneamino)pyridine-2-carboximidamide?
The InChIKey is NEBBUQSNLGZXCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4.C2H6.C2H4/c1-7(2)13-14-10(11)9-5-4-8(3)6-12-9;2*1-2/h4-6H,1-3H3,(H2,11,14);1-2H3;1-2H2.
What are the key properties of ethane;ethene;5-methyl-N'-(propan-2-ylideneamino)pyridine-2-carboximidamide?
ethane;ethene;5-methyl-N'-(propan-2-ylideneamino)pyridine-2-carboximidamide has a molecular weight of 248.37 g/mol, XLogP of 3.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethene;5-methyl-N'-(propan-2-ylideneamino)pyridine-2-carboximidamide is sourced from PubChem (CID 171564528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).