C20H26N2O2 — CID 171564849
2-(dimethylamino)-3-[(Z)-3-oxoprop-1-enyl]-4-(2,2,4,4-tetramethylcyclobutyl)oxybenzonitrile (PubChem CID 171564849) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-(dimethylamino)-3-[(Z)-3-oxoprop-1-enyl]-4-(2,2,4,4-tetramethylcyclobutyl)oxybenzonitrile.
| Compound Name | 2-(dimethylamino)-3-[(Z)-3-oxoprop-1-enyl]-4-(2,2,4,4-tetramethylcyclobutyl)oxybenzonitrile |
|---|---|
| PubChem CID | 171564849 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 2-(dimethylamino)-3-[(Z)-3-oxoprop-1-enyl]-4-(2,2,4,4-tetramethylcyclobutyl)oxybenzonitrile |
| SMILES | CN(C)c1c(C#N)ccc(OC2C(C)(C)CC2(C)C)c1/C=C\C=O |
| InChI | InChI=1S/C20H26N2O2/c1-19(2)13-20(3,4)18(19)24-16-10-9-14(12-21)17(22(5)6)15(16)8-7-11-23/h7-11,18H,13H2,1-6H3/b8-7- |
| InChIKey | FGNCZJDRHLZDIT-FPLPWBNLSA-N |
| XLogP | 4.04 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|