C14H22N2O2 — CID 171565174
ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1,3-diazinane-2,4-dione (PubChem CID 171565174) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1,3-diazinane-2,4-dione.
| Compound Name | ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 171565174 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1,3-diazinane-2,4-dione |
| SMILES | C=C/C(=C\C=C(C)C)N1CCC(=O)NC1=O.CC |
| InChI | InChI=1S/C12H16N2O2.C2H6/c1-4-10(6-5-9(2)3)14-8-7-11(15)13-12(14)16;1-2/h4-6H,1,7-8H2,2-3H3,(H,13,15,16);1-2H3/b10-6+; |
| InChIKey | BOMFTWFWEDYWRA-AAGWESIMSA-N |
| XLogP | 2.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|