C9H11FN2O2 — CID 144982590
1-[(3Z)-4-fluoropenta-1,3-dien-3-yl]-1,3-diazinane-2,4-dione (PubChem CID 144982590) has the molecular formula C9H11FN2O2 and a molecular weight of 198.20 g/mol. Its IUPAC name is 1-[(3Z)-4-fluoropenta-1,3-dien-3-yl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[(3Z)-4-fluoropenta-1,3-dien-3-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 144982590 |
| Molecular Formula | C9H11FN2O2 |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 1-[(3Z)-4-fluoropenta-1,3-dien-3-yl]-1,3-diazinane-2,4-dione |
| SMILES | C=C/C(=C(\C)F)N1CCC(=O)NC1=O |
| InChI | InChI=1S/C9H11FN2O2/c1-3-7(6(2)10)12-5-4-8(13)11-9(12)14/h3H,1,4-5H2,2H3,(H,11,13,14)/b7-6- |
| InChIKey | QLIJWTGTTGFTPQ-SREVYHEPSA-N |
| XLogP | 1.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|