C15H22N2O — CID 171083949
ethane;2-methylidene-1-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,3-diazinan-4-one (PubChem CID 171083949) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is ethane;2-methylidene-1-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,3-diazinan-4-one.
| Compound Name | ethane;2-methylidene-1-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 171083949 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | ethane;2-methylidene-1-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,3-diazinan-4-one |
| SMILES | C=C/C=C\C(=C/C=C)N1CCC(=O)NC1=C.CC |
| InChI | InChI=1S/C13H16N2O.C2H6/c1-4-6-8-12(7-5-2)15-10-9-13(16)14-11(15)3;1-2/h4-8H,1-3,9-10H2,(H,14,16);1-2H3/b8-6-,12-7+; |
| InChIKey | OMAOOXRYYIBUPM-NBWAZKHOSA-N |
| XLogP | 3.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|