C13H20N2O2 — CID 171565222
ethane;1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1,3-diazinane-2,4-dione (PubChem CID 171565222) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is ethane;1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1,3-diazinane-2,4-dione.
| Compound Name | ethane;1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 171565222 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | ethane;1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1,3-diazinane-2,4-dione |
| SMILES | C=C/C(=C\C=C/C)N1CCC(=O)NC1=O.CC |
| InChI | InChI=1S/C11H14N2O2.C2H6/c1-3-5-6-9(4-2)13-8-7-10(14)12-11(13)15;1-2/h3-6H,2,7-8H2,1H3,(H,12,14,15);1-2H3/b5-3-,9-6+; |
| InChIKey | FBRDEUWSYDDAHX-XRVNEYCPSA-N |
| XLogP | 2.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|