C10H9N2O2RuS — CID 156706986
ruthenium(1+);1-(3-sulfanylbenzene-6-id-1-yl)-1,3-diazinane-2,4-dione (PubChem CID 156706986) has the molecular formula C10H9N2O2RuS and a molecular weight of 322.33 g/mol. Its IUPAC name is ruthenium(1+);1-(3-sulfanylbenzene-6-id-1-yl)-1,3-diazinane-2,4-dione.
| Compound Name | ruthenium(1+);1-(3-sulfanylbenzene-6-id-1-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 156706986 |
| Molecular Formula | C10H9N2O2RuS |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.94 |
| IUPAC Name | ruthenium(1+);1-(3-sulfanylbenzene-6-id-1-yl)-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(c2[c-]ccc(S)c2)C(=O)N1.[Ru+] |
| InChI | InChI=1S/C10H9N2O2S.Ru/c13-9-4-5-12(10(14)11-9)7-2-1-3-8(15)6-7;/h1,3,6,15H,4-5H2,(H,11,13,14);/q-1;+1 |
| InChIKey | UUXWKTPLLZIVKS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|