C16H28N2O2 — CID 171565090
ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1,3-diazinane-2,4-dione (PubChem CID 171565090) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1,3-diazinane-2,4-dione.
| Compound Name | ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 171565090 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | ethane;1-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1,3-diazinane-2,4-dione |
| SMILES | C=C/C(=C\C=C(C)C)N1CCC(=O)NC1=O.CC.CC |
| InChI | InChI=1S/C12H16N2O2.2C2H6/c1-4-10(6-5-9(2)3)14-8-7-11(15)13-12(14)16;2*1-2/h4-6H,1,7-8H2,2-3H3,(H,13,15,16);2*1-2H3/b10-6+;; |
| InChIKey | FDYNORLGHFZKSE-DOLBFOAYSA-N |
| XLogP | 4.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|