C18H23N3O3 — CID 144530679
(5E)-5-[(2E,4Z)-5-(dimethylamino)-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienylidene]-1-ethyl-1,3-diazinane-2,4,6-trione (PubChem CID 144530679) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (5E)-5-[(2E,4Z)-5-(dimethylamino)-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienylidene]-1-ethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(2E,4Z)-5-(dimethylamino)-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienylidene]-1-ethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 144530679 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (5E)-5-[(2E,4Z)-5-(dimethylamino)-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienylidene]-1-ethyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=C/C(=C(\C=C/C)/C=C/C=C1\C(=O)NC(=O)N(CC)C1=O)N(C)C |
| InChI | InChI=1S/C18H23N3O3/c1-6-10-13(15(7-2)20(4)5)11-9-12-14-16(22)19-18(24)21(8-3)17(14)23/h6-7,9-12H,2,8H2,1,3-5H3,(H,19,22,24)/b10-6-,11-9+,14-12+,15-13- |
| InChIKey | JASLQHQJXAPMKE-AHJFPZFJSA-N |
| XLogP | 2.15 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|