C16H19F3N4O3 — CID 71671147
5-[1-[3-(dimethylamino)propyl]-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 71671147) has the molecular formula C16H19F3N4O3 and a molecular weight of 372.35 g/mol. Its IUPAC name is 5-[1-[3-(dimethylamino)propyl]-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[1-[3-(dimethylamino)propyl]-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 71671147 |
| Molecular Formula | C16H19F3N4O3 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 5-[1-[3-(dimethylamino)propyl]-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CC1=CC(=C2C(=O)NC(=O)NC2=O)C=C(C(F)(F)F)N1CCCN(C)C |
| InChI | InChI=1S/C16H19F3N4O3/c1-9-7-10(12-13(24)20-15(26)21-14(12)25)8-11(16(17,18)19)23(9)6-4-5-22(2)3/h7-8H,4-6H2,1-3H3,(H2,20,21,24,25,26) |
| InChIKey | XXNFPRQKYOQMDI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|