C10H10N2O3 — CID 176682095
1-[(3E)-hexa-1,3,5-trien-3-yl]-1,3-diazinane-2,4,6-trione (PubChem CID 176682095) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 1-[(3E)-hexa-1,3,5-trien-3-yl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 176682095 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]-1,3-diazinane-2,4,6-trione |
| SMILES | C=C/C=C(\C=C)N1C(=O)CC(=O)NC1=O |
| InChI | InChI=1S/C10H10N2O3/c1-3-5-7(4-2)12-9(14)6-8(13)11-10(12)15/h3-5H,1-2,6H2,(H,11,13,15)/b7-5+ |
| InChIKey | CMWAXSPURBBVRA-FNORWQNLSA-N |
| XLogP | 0.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|